Products 228111-40-8
CAS 228111-40-8 appears in our catalog under these names: 4-Nitrophenyl prop-2-yn-1-yl carbonate, 95%, 4–nitrophenyl prop–2–yn–1–yl carbonate, 4-nitrophenyl prop-2-yn-1-yl carbonate. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
(4-nitrophenyl) prop-2-ynyl carbonate (CAS 228111-40-8) is a chemical compound with the molecular formula C10H7NO5 and a molecular weight of 221.17 g/mol. IUPAC name: (4-nitrophenyl) prop-2-ynyl carbonate. InChIKey: ZFSTXYJGQDNJRW-UHFFFAOYSA-N.
| Molecular formula | C10H7NO5 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | (4-nitrophenyl) prop-2-ynyl carbonate |
| InChIKey | ZFSTXYJGQDNJRW-UHFFFAOYSA-N |
| SMILES | C#CCOC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)