cas: 13278-36-9 — see every product listed under this CAS number, including other names
2-((3-Chlorophenyl)amino)benzoic acid 98% (CAS 13278-36-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A773569-1g |
| cas | 13278-36-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 164.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A773569 |
2-(3-chloroanilino)benzoic acid (CAS 13278-36-9) is a chemical compound with the molecular formula C13H10ClNO2 and a molecular weight of 247.67 g/mol. IUPAC name: 2-(3-chloroanilino)benzoic acid. InChIKey: OVMWPVYEBVFZHM-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO2 |
|---|---|
| Molecular weight | 247.67 g/mol |
| IUPAC name | 2-(3-chloroanilino)benzoic acid |
| InChIKey | OVMWPVYEBVFZHM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)