Products 1261934-19-3

CAS 1261934-19-3 is the registry number for 5-(3-Chloro-4-methylphenyl)nicotinic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

5-(3-chloro-4-methylphenyl)pyridine-3-carboxylic acid (CAS 1261934-19-3) is a chemical compound with the molecular formula C13H10ClNO2 and a molecular weight of 247.67 g/mol. IUPAC name: 5-(3-chloro-4-methylphenyl)pyridine-3-carboxylic acid. InChIKey: JDWNMCYMVAHOMG-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10ClNO2
Molecular weight247.67 g/mol
IUPAC name5-(3-chloro-4-methylphenyl)pyridine-3-carboxylic acid
InChIKeyJDWNMCYMVAHOMG-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)C2=CC(=CN=C2)C(=O)O)Cl

Computed by PubChem (NCBI)