CAS 854860-15-4 appears in our catalog under these names: 6-Chloro-2-cyclopropylquinoline-4-carboxylic acid, 6-Chloro-2-cyclopropylquinoline-4-carboxylic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 0,5g, 1g, 250mg, 100mg.
6-chloro-2-cyclopropylquinoline-4-carboxylic acid (CAS 854860-15-4) is a chemical compound with the molecular formula C13H10ClNO2 and a molecular weight of 247.67 g/mol. IUPAC name: 6-chloro-2-cyclopropylquinoline-4-carboxylic acid. InChIKey: NQFVACCQTKXGON-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO2 |
|---|---|
| Molecular weight | 247.67 g/mol |
| IUPAC name | 6-chloro-2-cyclopropylquinoline-4-carboxylic acid |
| InChIKey | NQFVACCQTKXGON-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC3=C(C=C(C=C3)Cl)C(=C2)C(=O)O |
Computed by PubChem (NCBI)