cas: 51301-86-1 — see every product listed under this CAS number, including other names
2-((tert-Butoxycarbonyl)amino)-3-(4-chlorophenyl)propanoic acid, 98% (CAS 51301-86-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11DHV6-1g |
| cas | 51301-86-1 |
| size | 1g |
| availability | 300g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 10g | 198.80 Pln | |
| Chemat | 25g | 366.80 Pln | |
| Chemat | 100g | 1230.80 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 185.37 Pln | |
| Fluorochem | 10g | 258.26 Pln | |
| Fluorochem | 25g | 430.07 Pln | |
| Fluorochem | 100g | 1554.68 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 51301-86-1) is a chemical compound with the molecular formula C14H18ClNO4 and a molecular weight of 299.75 g/mol. IUPAC name: 3-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: BETBOAZCLSJOBQ-UHFFFAOYSA-N.
| Molecular formula | C14H18ClNO4 |
|---|---|
| Molecular weight | 299.75 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | BETBOAZCLSJOBQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)