CAS 68090-88-0 appears in our catalog under these names: Boc–Phe(4–Cl)–OH, Boc-L-Phe(4-Cl)-OH, N-(tert-Butoxycarbonyl)-4-chloro-L-phenylalanine, >98.0%(HPLC)(T), Boc-Phe(4-Cl)-OH, 97%, 97%, Boc-Phe(4-Cl)-OH, 99.90%. Offered by: GLPBio, Iris Biotech, TCI, Chemat, MedChemExpress. Available pack sizes: 10g, 100g, 25g, 1g, 5g, 250mg, 500 g, 10 g.
(2S)-3-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 68090-88-0) is a chemical compound with the molecular formula C14H18ClNO4 and a molecular weight of 299.75 g/mol. IUPAC name: (2S)-3-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: BETBOAZCLSJOBQ-NSHDSACASA-N.
| Molecular formula | C14H18ClNO4 |
|---|---|
| Molecular weight | 299.75 g/mol |
| IUPAC name | (2S)-3-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | BETBOAZCLSJOBQ-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)