cas: 521286-38-4 — see every product listed under this CAS number, including other names
2-([(TERT-BUTOXY)CARBONYL]AMINO)PENTANOIC ACID, 95%, 95% (CAS 521286-38-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114U55-1g |
| cas | 521286-38-4 |
| size | 1g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 25g | 150.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 521286-38-4) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: INWOAUUPYIXDHN-UHFFFAOYSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | INWOAUUPYIXDHN-UHFFFAOYSA-N |
| SMILES | CCCC(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)