Boc-DL-Nva-OH 95%
cas: 521286-38-4 — see every product listed under this CAS number, including other names
Boc-DL-Nva-OH 95% (CAS 521286-38-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A757124-1g |
| cas | 521286-38-4 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 25g | 286.94 Pln | |
| Ambeed | 100g | 743.06 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A757124 |
2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 521286-38-4) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: INWOAUUPYIXDHN-UHFFFAOYSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | INWOAUUPYIXDHN-UHFFFAOYSA-N |
| SMILES | CCCC(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
2-{[(tert-butoxy)carbonyl]amino}pentanoic acid, 2-(((Tert-butoxy)carbonyl)amino)pentanoic acid, rac-Boc Norvaline, 2-(Boc-amino)pentanoic Acid, 2-((tert-Butoxycarbonyl)amino)pentanoic acid, Boc-D-2-aminovaleric acid, Boc-DL-norvaline, 2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid, N-Boc-aminovaleric acid, 2-tert-Butoxycarbonylamino-pentanoic acid