cas: 1239700-56-1 — see every product listed under this CAS number, including other names
2-(1-(2-Chlorophenyl)vinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, ≥97-<99% (CAS 1239700-56-1) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC355-97-99-500mg |
| cas | 1239700-56-1 |
| size | 500mg |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 500mg | 4059.44 Pln | |
| Hoffman Fine Chemicals | 1g | 6075.52 Pln | |
| Hoffman Fine Chemicals | 2,5g | 10394.78 Pln | |
| Hoffman Fine Chemicals | 5g | 17591.42 Pln | |
| Hoffman Fine Chemicals | 10g | 29113.70 Pln |
| purity | ≥97-<99% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
2-[1-(2-chlorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1239700-56-1) is a chemical compound with the molecular formula C14H18BClO2 and a molecular weight of 264.56 g/mol. IUPAC name: 2-[1-(2-chlorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: LLYOIGXBMLPFMQ-UHFFFAOYSA-N.
| Molecular formula | C14H18BClO2 |
|---|---|
| Molecular weight | 264.56 g/mol |
| IUPAC name | 2-[1-(2-chlorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | LLYOIGXBMLPFMQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(=C)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)