CAS 1239700-56-1 appears in our catalog under these names: 2-(1-(2-Chlorophenyl)vinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95-<97%, 2-(1-(2-Chlorophenyl)vinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, ≥97-<99%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
2-[1-(2-chlorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1239700-56-1) is a chemical compound with the molecular formula C14H18BClO2 and a molecular weight of 264.56 g/mol. IUPAC name: 2-[1-(2-chlorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: LLYOIGXBMLPFMQ-UHFFFAOYSA-N.
| Molecular formula | C14H18BClO2 |
|---|---|
| Molecular weight | 264.56 g/mol |
| IUPAC name | 2-[1-(2-chlorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | LLYOIGXBMLPFMQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(=C)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)