CAS 850567-54-3 appears in our catalog under these names: 1-(4-Chlorophenyl)vinylboronic acid, pinacol ester, 98%, 1–(4–Chlorophenyl)vinylboronic acid, pinacol ester, 2-(1-(4-Chlorophenyl)vinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98% mix TBC as stabilizer, 2-(1-(4-Chlorophenyl)vinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98% mix TBC as stabilizer, 98% mix TBC as stabilizer, 2-(1-(4-Chlorophenyl)vinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 500mg.
2-[1-(4-chlorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 850567-54-3) is a chemical compound with the molecular formula C14H18BClO2 and a molecular weight of 264.56 g/mol. IUPAC name: 2-[1-(4-chlorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: JGSGBFKOANEXOW-UHFFFAOYSA-N.
| Molecular formula | C14H18BClO2 |
|---|---|
| Molecular weight | 264.56 g/mol |
| IUPAC name | 2-[1-(4-chlorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | JGSGBFKOANEXOW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(=C)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)