CAS 1765-92-0 appears in our catalog under these names: 1H,1H-Heptafluorobutyl epoxide, 95%, 2-(2,2,3,3,4,4,4-Heptafluorobutyl)oxirane, 95%, 95%, 3-(Perfluoropropyl)-1,2-propenoxide, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g.
2-(2,2,3,3,4,4,4-heptafluorobutyl)oxirane (CAS 1765-92-0) is a chemical compound with the molecular formula C6H5F7O and a molecular weight of 226.09 g/mol. IUPAC name: 2-(2,2,3,3,4,4,4-heptafluorobutyl)oxirane. InChIKey: YXNWXQYDINSHJC-UHFFFAOYSA-N.
| Molecular formula | C6H5F7O |
|---|---|
| Molecular weight | 226.09 g/mol |
| IUPAC name | 2-(2,2,3,3,4,4,4-heptafluorobutyl)oxirane |
| InChIKey | YXNWXQYDINSHJC-UHFFFAOYSA-N |
| SMILES | C1C(O1)CC(C(C(F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)