CAS 37759-88-9 is the registry number for 4,4,5,5,6,6,6-Heptafluorohex-2-en-1-ol, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(E)-4,4,5,5,6,6,6-heptafluorohex-2-en-1-ol (CAS 37759-88-9) is a chemical compound with the molecular formula C6H5F7O and a molecular weight of 226.09 g/mol. IUPAC name: (E)-4,4,5,5,6,6,6-heptafluorohex-2-en-1-ol. InChIKey: FJRYHIWIYHYOTE-OWOJBTEDSA-N.
| Molecular formula | C6H5F7O |
|---|---|
| Molecular weight | 226.09 g/mol |
| IUPAC name | (E)-4,4,5,5,6,6,6-heptafluorohex-2-en-1-ol |
| InChIKey | FJRYHIWIYHYOTE-OWOJBTEDSA-N |
| SMILES | C(/C=C/C(C(C(F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)