CAS 15242-17-8 is the registry number for Allyl heptafluoroisopropyl ether, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
1,1,1,2,3,3,3-heptafluoro-2-prop-2-enoxypropane (CAS 15242-17-8) is a chemical compound with the molecular formula C6H5F7O and a molecular weight of 226.09 g/mol. IUPAC name: 1,1,1,2,3,3,3-heptafluoro-2-prop-2-enoxypropane. InChIKey: FXUHCQHWDACOKK-UHFFFAOYSA-N.
| Molecular formula | C6H5F7O |
|---|---|
| Molecular weight | 226.09 g/mol |
| IUPAC name | 1,1,1,2,3,3,3-heptafluoro-2-prop-2-enoxypropane |
| InChIKey | FXUHCQHWDACOKK-UHFFFAOYSA-N |
| SMILES | C=CCOC(C(F)(F)F)(C(F)(F)F)F |
Computed by PubChem (NCBI)