cas: 1255760-30-5 — see every product listed under this CAS number, including other names
2-(2,3-Dichlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97% (CAS 1255760-30-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627523-5G |
| cas | 1255760-30-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 325.94 Pln | |
| Fluorochem | 10g | 596.68 Pln | |
| Fluorochem | 25g | 1408.90 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(2,3-dichlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1255760-30-5) is a chemical compound with the molecular formula C12H15BCl2O2 and a molecular weight of 273.0 g/mol. IUPAC name: 2-(2,3-dichlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: XJOWNMGMNMPVRL-UHFFFAOYSA-N.
| Molecular formula | C12H15BCl2O2 |
|---|---|
| Molecular weight | 273.0 g/mol |
| IUPAC name | 2-(2,3-dichlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | XJOWNMGMNMPVRL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)