Products 69807-92-7
CAS 69807-92-7 appears in our catalog under these names: 2,6-Dichlorophenylboronic acid pinacol ester, 98%, 2-(2,6-Dichlorophenyl)-4,4,5,5-Tetramethyl-1,3,2-Dioxaborolane, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 100mg, 250mg, 1g.
2-(2,6-dichlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 69807-92-7) is a chemical compound with the molecular formula C12H15BCl2O2 and a molecular weight of 273.0 g/mol. IUPAC name: 2-(2,6-dichlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: WKXMSUKHFIHUEW-UHFFFAOYSA-N.
| Molecular formula | C12H15BCl2O2 |
|---|---|
| Molecular weight | 273.0 g/mol |
| IUPAC name | 2-(2,6-dichlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | WKXMSUKHFIHUEW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)