cas: 2737271-23-5 — see every product listed under this CAS number, including other names
2-(2,3-Difluoro-6-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98% (CAS 2737271-23-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch131L73-100mg |
| cas | 2737271-23-5 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 333.20 Pln | |
| Chemat | 10g | 1394.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(2,3-difluoro-6-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2737271-23-5) is a chemical compound with the molecular formula C13H17BF2O3 and a molecular weight of 270.08 g/mol. IUPAC name: 2-(2,3-difluoro-6-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: GJWVHXVYEOZQIG-UHFFFAOYSA-N.
| Molecular formula | C13H17BF2O3 |
|---|---|
| Molecular weight | 270.08 g/mol |
| IUPAC name | 2-(2,3-difluoro-6-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | GJWVHXVYEOZQIG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2F)F)OC |
Computed by PubChem (NCBI)