CAS 960067-33-8 appears in our catalog under these names: 2-Difluoromethoxyphenylboronic acid, pinacol ester, 95%, 2-(2-(Difluoromethoxy)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95-<97%, 2-Difluoromethoxyphenylboronic Acid, Pinacol Ester, 2–(2–(Difluoromethoxy)phenyl)–4,4,5,5–tetramethyl–1,3,2–dioxaborolane, 2-Difluoromethoxyphenylboronic acid pinacol ester. Offered by: Combi-blocks, Hoffman Fine Chemicals, TRC, GLPBio, Biosynth. Available pack sizes: 100mg, 5g, 1g, 10g, 250mg, 25g, 50g, 100g.
2-[2-(difluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 960067-33-8) is a chemical compound with the molecular formula C13H17BF2O3 and a molecular weight of 270.08 g/mol. IUPAC name: 2-[2-(difluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ZIBYFIJKYIKOEX-UHFFFAOYSA-N.
| Molecular formula | C13H17BF2O3 |
|---|---|
| Molecular weight | 270.08 g/mol |
| IUPAC name | 2-[2-(difluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ZIBYFIJKYIKOEX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2OC(F)F |
Computed by PubChem (NCBI)