CAS 754226-38-5 appears in our catalog under these names: 3,4-Difluoro-5-methoxyphenylboronic acid, pinacol ester, 95%, 3,4-Difluoro-5-methoxyphenylboronic acid, pinacol ester, 95%, 95%, 2-(3,4-Difluoro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 250mg, 5g, 100mg.
2-(3,4-difluoro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 754226-38-5) is a chemical compound with the molecular formula C13H17BF2O3 and a molecular weight of 270.08 g/mol. IUPAC name: 2-(3,4-difluoro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FVCQRVQOTYWNHV-UHFFFAOYSA-N.
| Molecular formula | C13H17BF2O3 |
|---|---|
| Molecular weight | 270.08 g/mol |
| IUPAC name | 2-(3,4-difluoro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FVCQRVQOTYWNHV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)F)F)OC |
Computed by PubChem (NCBI)