cas: 391604-55-0 — see every product listed under this CAS number, including other names
2-(2,4-Difluorophenyl)pyridine 98% (CAS 391604-55-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A150452-1g |
| cas | 391604-55-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 353.69 Pln | |
| Ambeed | 100g | 1193.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A150452 |
2-(2,4-difluorophenyl)pyridine (CAS 391604-55-0) is a chemical compound with the molecular formula C11H7F2N and a molecular weight of 191.18 g/mol. IUPAC name: 2-(2,4-difluorophenyl)pyridine. InChIKey: SSABEFIRGJISFH-UHFFFAOYSA-N.
| Molecular formula | C11H7F2N |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 2-(2,4-difluorophenyl)pyridine |
| InChIKey | SSABEFIRGJISFH-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)