cas: 383127-70-6 — see every product listed under this CAS number, including other names
2-(2,5-Dichlorophenyl)pyrrolidine 95% (CAS 383127-70-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A584880-100mg |
| cas | 383127-70-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 381.50 Pln | |
| Ambeed | 250mg | 620.69 Pln | |
| Ambeed | 1g | 1538.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A584880 |
2-(2,5-dichlorophenyl)pyrrolidine (CAS 383127-70-6) is a chemical compound with the molecular formula C10H11Cl2N and a molecular weight of 216.10 g/mol. IUPAC name: 2-(2,5-dichlorophenyl)pyrrolidine. InChIKey: QPWHFAUOXMVIQL-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N |
|---|---|
| Molecular weight | 216.10 g/mol |
| IUPAC name | 2-(2,5-dichlorophenyl)pyrrolidine |
| InChIKey | QPWHFAUOXMVIQL-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)