CAS 1260771-31-0 appears in our catalog under these names: 3-(2,3-Dichlorophenyl)pyrrolidine, 95%, 3–(2,3–Dichlorophenyl)pyrrolidine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
3-(2,3-dichlorophenyl)pyrrolidine (CAS 1260771-31-0) is a chemical compound with the molecular formula C10H11Cl2N and a molecular weight of 216.10 g/mol. IUPAC name: 3-(2,3-dichlorophenyl)pyrrolidine. InChIKey: KKGNZEVIDMVXEE-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N |
|---|---|
| Molecular weight | 216.10 g/mol |
| IUPAC name | 3-(2,3-dichlorophenyl)pyrrolidine |
| InChIKey | KKGNZEVIDMVXEE-UHFFFAOYSA-N |
| SMILES | C1CNCC1C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)