CAS 1270410-78-0 is the registry number for Cyclopropyl(2,3-dichlorophenyl)methanamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Cyclopropyl-(2,3-dichlorophenyl)methanamine (CAS 1270410-78-0) is a chemical compound with the molecular formula C10H11Cl2N and a molecular weight of 216.10 g/mol. IUPAC name: cyclopropyl-(2,3-dichlorophenyl)methanamine. InChIKey: OWYGIZQRPLUCNT-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N |
|---|---|
| Molecular weight | 216.10 g/mol |
| IUPAC name | cyclopropyl-(2,3-dichlorophenyl)methanamine |
| InChIKey | OWYGIZQRPLUCNT-UHFFFAOYSA-N |
| SMILES | C1CC1C(C2=C(C(=CC=C2)Cl)Cl)N |
Computed by PubChem (NCBI)