cas: 408492-25-1 — see every product listed under this CAS number, including other names
2-(2,5-Difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97% (CAS 408492-25-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F614603-100MG |
| cas | 408492-25-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 96.86 Pln | |
| Fluorochem | 250mg | 159.34 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(2,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 408492-25-1) is a chemical compound with the molecular formula C12H15BF2O2 and a molecular weight of 240.06 g/mol. IUPAC name: 2-(2,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: WNHQMCOFRAYOJV-UHFFFAOYSA-N.
| Molecular formula | C12H15BF2O2 |
|---|---|
| Molecular weight | 240.06 g/mol |
| IUPAC name | 2-(2,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | WNHQMCOFRAYOJV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)F)F |
Computed by PubChem (NCBI)