Products 1073339-17-9
CAS 1073339-17-9 appears in our catalog under these names: (2,3-DIFLUOROPHENYL)BORONIC ACID PINACOL ESTER, 97%, 2-(2,3-Difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 2-(2,3-Difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg, 100mg, 50g, 100g.
2-(2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1073339-17-9) is a chemical compound with the molecular formula C12H15BF2O2 and a molecular weight of 240.06 g/mol. IUPAC name: 2-(2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: BFCCQFHEIXEEKP-UHFFFAOYSA-N.
| Molecular formula | C12H15BF2O2 |
|---|---|
| Molecular weight | 240.06 g/mol |
| IUPAC name | 2-(2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | BFCCQFHEIXEEKP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)F)F |
Computed by PubChem (NCBI)