cas: 212127-80-5 — see every product listed under this CAS number, including other names
2-(2,5-dihydrofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97% (CAS 212127-80-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11496O-100mg |
| cas | 212127-80-5 |
| size | 100mg |
| availability | 250g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 957.20 Pln | |
| Chemat | 10g | 1854.80 Pln | |
| Chemat | 25g | 3923.60 Pln | |
| Chemat | 250g | 24419.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(2,5-dihydrofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 212127-80-5) is a chemical compound with the molecular formula C10H17BO3 and a molecular weight of 196.05 g/mol. IUPAC name: 2-(2,5-dihydrofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FCRCZWHPQMJOSH-UHFFFAOYSA-N.
| Molecular formula | C10H17BO3 |
|---|---|
| Molecular weight | 196.05 g/mol |
| IUPAC name | 2-(2,5-dihydrofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FCRCZWHPQMJOSH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCOC2 |
Computed by PubChem (NCBI)