Products 634196-63-7

CAS 634196-63-7 is the registry number for 3-Methoxy-1-propyn-1-ylboronic acid, pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(3-methoxyprop-1-ynyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 634196-63-7) is a chemical compound with the molecular formula C10H17BO3 and a molecular weight of 196.05 g/mol. IUPAC name: 2-(3-methoxyprop-1-ynyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: BJDZPOHVHLSGDP-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17BO3
Molecular weight196.05 g/mol
IUPAC name2-(3-methoxyprop-1-ynyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
InChIKeyBJDZPOHVHLSGDP-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C#CCOC

Computed by PubChem (NCBI)