CAS 1046812-03-6 appears in our catalog under these names: 4,5-Dihydrofuran-3-boronic acid pinacol ester, 96%, 4,5-Dihydrofuran-3-boronic Acid Pinacol Ester, 2–(4,5–Dihydrofuran–3–yl)–4,4,5,5–tetramethyl–1,3,2–dioxaborolane, 2-(4,5-Dihydrofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98%, 2-(4,5-Dihydrofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 2,5g, 100mg, 10mg, 25mg, 50mg.
2-(2,3-dihydrofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1046812-03-6) is a chemical compound with the molecular formula C10H17BO3 and a molecular weight of 196.05 g/mol. IUPAC name: 2-(2,3-dihydrofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: NVQMFAGDOWSMOK-UHFFFAOYSA-N.
| Molecular formula | C10H17BO3 |
|---|---|
| Molecular weight | 196.05 g/mol |
| IUPAC name | 2-(2,3-dihydrofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | NVQMFAGDOWSMOK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=COCC2 |
Computed by PubChem (NCBI)