cas: 1310048-99-7 — see every product listed under this CAS number, including other names
2-(2,6-Dimethylbenzyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98% (CAS 1310048-99-7) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1808970-25g |
| cas | 1310048-99-7 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 12764.50 Pln | |
| AmBeed | 10g | 6417.25 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[(2,6-dimethylphenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1310048-99-7) is a chemical compound with the molecular formula C15H23BO2 and a molecular weight of 246.15 g/mol. IUPAC name: 2-[(2,6-dimethylphenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: GHMGVDLXBXCTKK-UHFFFAOYSA-N.
| Molecular formula | C15H23BO2 |
|---|---|
| Molecular weight | 246.15 g/mol |
| IUPAC name | 2-[(2,6-dimethylphenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | GHMGVDLXBXCTKK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2=C(C=CC=C2C)C |
Computed by PubChem (NCBI)