cas: 64485-88-7 — see every product listed under this CAS number, including other names
2-(2-Amino-4-thiazolyl)-2(Z)(methoxy)imino ethyl acetate, 98%, 98% (CAS 64485-88-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CPP-5g |
| cas | 64485-88-7 |
| size | 5g |
| availability | 2500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 25g | 107.60 Pln | |
| Chemat | 100g | 179.60 Pln | |
| Chemat | 500g | 720.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetate (CAS 64485-88-7) is a chemical compound with the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. IUPAC name: ethyl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetate. InChIKey: POBMBNPEUPDXRS-WDZFZDKYSA-N.
| Molecular formula | C8H11N3O3S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | ethyl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetate |
| InChIKey | POBMBNPEUPDXRS-WDZFZDKYSA-N |
| SMILES | CCOC(=O)/C(=N\OC)/C1=CSC(=N1)N |
Computed by PubChem (NCBI)