CAS 160707-69-7 appears in our catalog under these names: Apricitabine, 98%, (-)-2'-Deoxy-3'-oxa-4'-thiocytidine (Apricitabine), Apricitabine, 95+%, Apricitabine/ 100%, Apricitabine. Offered by: Combi-blocks, TRC, AmBeed, TargetMol, GLPBio. Available pack sizes: 250mg, 100mg, 10mg, 50mg, 5mg, 1mg, 25mg, 500mg.
4-amino-1-[(2R,4R)-2-(hydroxymethyl)-1,3-oxathiolan-4-yl]pyrimidin-2-one (CAS 160707-69-7) is a chemical compound with the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. IUPAC name: 4-amino-1-[(2R,4R)-2-(hydroxymethyl)-1,3-oxathiolan-4-yl]pyrimidin-2-one. InChIKey: RYMCFYKJDVMSIR-RNFRBKRXSA-N.
| Molecular formula | C8H11N3O3S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 4-amino-1-[(2R,4R)-2-(hydroxymethyl)-1,3-oxathiolan-4-yl]pyrimidin-2-one |
| InChIKey | RYMCFYKJDVMSIR-RNFRBKRXSA-N |
| SMILES | C1[C@@H](S[C@@H](O1)CO)N2C=CC(=NC2=O)N |
Computed by PubChem (NCBI)