CAS 83244-85-3 is the registry number for [(5-Isobutyl-1,3,4-thiadiazol-2-yl)amino](oxo)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-[[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]amino]-2-oxoacetic acid (CAS 83244-85-3) is a chemical compound with the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. IUPAC name: 2-[[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]amino]-2-oxoacetic acid. InChIKey: ZLESBFCTCSUMSO-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O3S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 2-[[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]amino]-2-oxoacetic acid |
| InChIKey | ZLESBFCTCSUMSO-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=NN=C(S1)NC(=O)C(=O)O |
Computed by PubChem (NCBI)