Products 83244-85-3

CAS 83244-85-3 is the registry number for [(5-Isobutyl-1,3,4-thiadiazol-2-yl)amino](oxo)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]amino]-2-oxoacetic acid (CAS 83244-85-3) is a chemical compound with the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. IUPAC name: 2-[[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]amino]-2-oxoacetic acid. InChIKey: ZLESBFCTCSUMSO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11N3O3S
Molecular weight229.26 g/mol
IUPAC name2-[[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]amino]-2-oxoacetic acid
InChIKeyZLESBFCTCSUMSO-UHFFFAOYSA-N
SMILESCC(C)CC1=NN=C(S1)NC(=O)C(=O)O

Computed by PubChem (NCBI)