cas: 1151564-03-2 — see every product listed under this CAS number, including other names
2-(2-Chloro-3-methoxyphenyl)-4,4,5,5-tetramethyl-[1,3,2]dioxaborolane 97% (CAS 1151564-03-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A142440-100mg |
| cas | 1151564-03-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 264.69 Pln | |
| Ambeed | 5g | 909.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A142440 |
2-(2-chloro-3-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1151564-03-2) is a chemical compound with the molecular formula C13H18BClO3 and a molecular weight of 268.54 g/mol. IUPAC name: 2-(2-chloro-3-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CVPMKYBFBINSHI-UHFFFAOYSA-N.
| Molecular formula | C13H18BClO3 |
|---|---|
| Molecular weight | 268.54 g/mol |
| IUPAC name | 2-(2-chloro-3-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | CVPMKYBFBINSHI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)OC)Cl |
Computed by PubChem (NCBI)