2-(2-Chlorophenyl)cyclopentanone, 97%
cas: 1242029-81-7 — see every product listed under this CAS number, including other names
2-(2-Chlorophenyl)cyclopentanone, 97% (CAS 1242029-81-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A297686-100mg |
| cas | 1242029-81-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 337.00 Pln | |
| Ambeed | 250mg | 526.12 Pln | |
| Ambeed | 1g | 1310.44 Pln | |
| Ambeed | 5g | 4147.31 Pln | |
| Ambeed | 10g | 6945.25 Pln | |
| Ambeed | 25g | 14699.38 Pln | |
| BLDpharm | 100mg | 353.23 Pln | |
| BLDpharm | 250mg | 558.72 Pln | |
| BLDpharm | 1g | 1402.86 Pln | |
| BLDpharm | 5g | 4462.90 Pln | |
| BLDpharm | 10g | 7484.06 Pln | |
| BLDpharm | 25g | 14414.95 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-(2-chlorophenyl)cyclopentan-1-one (CAS 1242029-81-7) is a chemical compound with the molecular formula C11H11ClO and a molecular weight of 194.66 g/mol. IUPAC name: 2-(2-chlorophenyl)cyclopentan-1-one. InChIKey: PUZOTYDHLWXFFP-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | 2-(2-chlorophenyl)cyclopentan-1-one |
| InChIKey | PUZOTYDHLWXFFP-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)C1)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)