Products 41202-24-8
CAS 41202-24-8 appears in our catalog under these names: 2-Chloro-1-(2,3-dihydro-1h-inden-5-yl)ethanone, 95%, 2-Chloro-1-(2,3-dihydro-1H-inden-5-yl)ethan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 50mg, 0,5g.
2-chloro-1-(2,3-dihydro-1H-inden-5-yl)ethanone (CAS 41202-24-8) is a chemical compound with the molecular formula C11H11ClO and a molecular weight of 194.66 g/mol. IUPAC name: 2-chloro-1-(2,3-dihydro-1H-inden-5-yl)ethanone. InChIKey: OJAALMGLOFSSHR-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | 2-chloro-1-(2,3-dihydro-1H-inden-5-yl)ethanone |
| InChIKey | OJAALMGLOFSSHR-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)C(=O)CCl |
Computed by PubChem (NCBI)