CAS 54839-12-2 appears in our catalog under these names: 1–(4–Chlorophenyl)–2–cyclopropylethanone, 1-(4-Chlorophenyl)-2-cyclopropylethanone, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
1-(4-chlorophenyl)-2-cyclopropylethanone (CAS 54839-12-2) is a chemical compound with the molecular formula C11H11ClO and a molecular weight of 194.66 g/mol. IUPAC name: 1-(4-chlorophenyl)-2-cyclopropylethanone. InChIKey: QKCYUBJJPXLRFJ-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2-cyclopropylethanone |
| InChIKey | QKCYUBJJPXLRFJ-UHFFFAOYSA-N |
| SMILES | C1CC1CC(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)