2-(2-Chlorophenyl)piperidine hydrochloride, 97%
cas: 1177348-56-9 — see every product listed under this CAS number, including other names
2-(2-Chlorophenyl)piperidine hydrochloride, 97% (CAS 1177348-56-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A500482-250mg |
| cas | 1177348-56-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 498.31 Pln | |
| Ambeed | 1g | 948.88 Pln | |
| Ambeed | 5g | 2801.19 Pln | |
| BLDpharm | 100mg | 331.02 Pln | |
| BLDpharm | 250mg | 530.95 Pln | |
| BLDpharm | 1g | 1019.67 Pln | |
| BLDpharm | 5g | 3013.41 Pln | |
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 395.60 Pln | |
| Chemat | 1g | 736.40 Pln | |
| Chemat | 5g | 2752.40 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-(2-chlorophenyl)piperidine;hydrochloride (CAS 1177348-56-9) is a chemical compound with the molecular formula C11H15Cl2N and a molecular weight of 232.15 g/mol. IUPAC name: 2-(2-chlorophenyl)piperidine;hydrochloride. InChIKey: JSLCRQHGUYZXTL-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2N |
|---|---|
| Molecular weight | 232.15 g/mol |
| IUPAC name | 2-(2-chlorophenyl)piperidine;hydrochloride |
| InChIKey | JSLCRQHGUYZXTL-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C2=CC=CC=C2Cl.Cl |
Computed by PubChem (NCBI)
