cas: 1177348-56-9 — see every product listed under this CAS number, including other names
2-(2-Chlorophenyl)piperidine, HCl, 97% (CAS 1177348-56-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F636199-100MG |
| cas | 1177348-56-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 357.18 Pln | |
| Fluorochem | 250mg | 565.44 Pln | |
| Fluorochem | 1g | 1080.89 Pln | |
| Fluorochem | 5g | 3163.49 Pln | |
| Fluorochem | 10g | 4683.79 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(2-chlorophenyl)piperidine;hydrochloride (CAS 1177348-56-9) is a chemical compound with the molecular formula C11H15Cl2N and a molecular weight of 232.15 g/mol. IUPAC name: 2-(2-chlorophenyl)piperidine;hydrochloride. InChIKey: JSLCRQHGUYZXTL-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2N |
|---|---|
| Molecular weight | 232.15 g/mol |
| IUPAC name | 2-(2-chlorophenyl)piperidine;hydrochloride |
| InChIKey | JSLCRQHGUYZXTL-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C2=CC=CC=C2Cl.Cl |
Computed by PubChem (NCBI)