2-(2-Fluoro-4-isopropoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%
cas: 2121515-28-2 — see every product listed under this CAS number, including other names
2-(2-Fluoro-4-isopropoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97% (CAS 2121515-28-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A653720-250mg |
| cas | 2121515-28-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 731.94 Pln | |
| Ambeed | 1g | 1894.50 Pln | |
| BLDpharm | 100mg | 497.63 Pln | |
| BLDpharm | 250mg | 780.86 Pln | |
| BLDpharm | 1g | 2035.97 Pln | |
| Fluorochem | 1g | 1945.17 Pln | |
| Fluorochem | 100mg | 476.93 Pln | |
| Fluorochem | 250mg | 747.67 Pln | |
| Fluorochem | 5g | 7864.96 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-(2-fluoro-4-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121515-28-2) is a chemical compound with the molecular formula C15H22BFO3 and a molecular weight of 280.14 g/mol. IUPAC name: 2-(2-fluoro-4-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: JAXVBAKRKKWGHG-UHFFFAOYSA-N.
| Molecular formula | C15H22BFO3 |
|---|---|
| Molecular weight | 280.14 g/mol |
| IUPAC name | 2-(2-fluoro-4-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | JAXVBAKRKKWGHG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)OC(C)C)F |
Computed by PubChem (NCBI)
Synonyms:
2-Fluoro-4-isopropoxyphenylboronic acid pinacol ester, 2-(2-fluoro-4-isopropoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-(2-fluoro-4-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-(2-fluoro-4-isopropoxy-phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 1,3,2-Dioxaborolane, 2-[2-fluoro-4-(1-methylethoxy)phenyl]-4,4,5,5-tetramethyl-