CAS 1497435-85-4 appears in our catalog under these names: 5-Fluoro-2-isopropoxyphenylboronic acid pinacol ester, 98%, 5-Fluoro-2-isopropoxyphenylboronic acid pinacol ester, 98%, 98%, 2-(5-Fluoro-2-isopropoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 25g, 5g, 100mg.
2-(5-fluoro-2-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1497435-85-4) is a chemical compound with the molecular formula C15H22BFO3 and a molecular weight of 280.14 g/mol. IUPAC name: 2-(5-fluoro-2-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: XDYMKFWQGLKSAV-UHFFFAOYSA-N.
| Molecular formula | C15H22BFO3 |
|---|---|
| Molecular weight | 280.14 g/mol |
| IUPAC name | 2-(5-fluoro-2-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | XDYMKFWQGLKSAV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)F)OC(C)C |
Computed by PubChem (NCBI)