CAS 2121515-28-2 appears in our catalog under these names: 2-(2-Fluoro-4-isopropoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 2-Fluoro-4-isopropoxyphenylboronic acid pinacol ester, 95%, 2-Fluoro-4-isopropoxyphenylboronic acid pinacol ester, 97%, 97%. Offered by: Fluorochem, Ambeed, Combi-blocks, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
2-(2-fluoro-4-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121515-28-2) is a chemical compound with the molecular formula C15H22BFO3 and a molecular weight of 280.14 g/mol. IUPAC name: 2-(2-fluoro-4-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: JAXVBAKRKKWGHG-UHFFFAOYSA-N.
| Molecular formula | C15H22BFO3 |
|---|---|
| Molecular weight | 280.14 g/mol |
| IUPAC name | 2-(2-fluoro-4-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | JAXVBAKRKKWGHG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)OC(C)C)F |
Computed by PubChem (NCBI)