cas: 1073353-89-5 — see every product listed under this CAS number, including other names
2-(2-Fluoro-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98+%, 98+% (CAS 1073353-89-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119SU1-100mg |
| cas | 1073353-89-5 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 290.00 Pln | |
| Chemat | 5g | 904.40 Pln | |
| Chemat | 25g | 3016.40 Pln | |
| Chemat | 100g | 8834.00 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
2-(2-fluoro-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1073353-89-5) is a chemical compound with the molecular formula C12H15BFNO4 and a molecular weight of 267.06 g/mol. IUPAC name: 2-(2-fluoro-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: QYXHQOSFZITWSU-UHFFFAOYSA-N.
| Molecular formula | C12H15BFNO4 |
|---|---|
| Molecular weight | 267.06 g/mol |
| IUPAC name | 2-(2-fluoro-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | QYXHQOSFZITWSU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)[N+](=O)[O-])F |
Computed by PubChem (NCBI)