cas: 335343-05-0 — see every product listed under this CAS number, including other names
2-(2-Methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane, 95-<97% (CAS 335343-05-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC1058-95-97-10g |
| cas | 335343-05-0 |
| size | 10g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 10g | 3172.62 Pln | |
| Hoffman Fine Chemicals | 25g | 5864.98 Pln | |
| Hoffman Fine Chemicals | 50g | 9201.72 Pln | |
| Hoffman Fine Chemicals | 100g | 14541.78 Pln | |
| Hoffman Fine Chemicals | 200g | 23078.22 Pln | |
| Hoffman Fine Chemicals | 300g | 29337.00 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
2-(2-methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane (CAS 335343-05-0) is a chemical compound with the molecular formula C12H17BO3 and a molecular weight of 220.07 g/mol. IUPAC name: 2-(2-methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane. InChIKey: BEQHZRSAYLTONI-UHFFFAOYSA-N.
| Molecular formula | C12H17BO3 |
|---|---|
| Molecular weight | 220.07 g/mol |
| IUPAC name | 2-(2-methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| InChIKey | BEQHZRSAYLTONI-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=CC=C2OC |
Computed by PubChem (NCBI)