CAS 213596-33-9 appears in our catalog under these names: 2-(4-Methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane, 97%, 2-(4-Methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane, 95-<97%, 2-(4-Methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane, ≥97-<99%, 4–methoxyphenylboronic acid 2,2–dimethyl–1,3–propanediol ester, 2-(4-Methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane 97%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 100g, 200g, 300g, 400g, 500g.
2-(4-methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane (CAS 213596-33-9) is a chemical compound with the molecular formula C12H17BO3 and a molecular weight of 220.07 g/mol. IUPAC name: 2-(4-methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane. InChIKey: JTJMYIZHNJBNRY-UHFFFAOYSA-N.
| Molecular formula | C12H17BO3 |
|---|---|
| Molecular weight | 220.07 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| InChIKey | JTJMYIZHNJBNRY-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)