Products 1313760-64-3
CAS 1313760-64-3 appears in our catalog under these names: [2-(Cyclopentyloxy)-5-methylphenyl]boranediol, 95%, (2-(Cyclopentyloxy)-5-methylphenyl)boronic acid, 95%, (2-(Cyclopentyloxy)-5-methylphenyl)boronic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 5g, 1g, 0,5g, 50mg.
(2-cyclopentyloxy-5-methylphenyl)boronic acid (CAS 1313760-64-3) is a chemical compound with the molecular formula C12H17BO3 and a molecular weight of 220.07 g/mol. IUPAC name: (2-cyclopentyloxy-5-methylphenyl)boronic acid. InChIKey: GGLMKUJEQSKWOG-UHFFFAOYSA-N.
| Molecular formula | C12H17BO3 |
|---|---|
| Molecular weight | 220.07 g/mol |
| IUPAC name | (2-cyclopentyloxy-5-methylphenyl)boronic acid |
| InChIKey | GGLMKUJEQSKWOG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C)OC2CCCC2)(O)O |
Computed by PubChem (NCBI)