cas: 114953-81-0 — see every product listed under this CAS number, including other names
2-(2-Nitrophenyl)acetohydrazide 95+% (CAS 114953-81-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A532525-1g |
| cas | 114953-81-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 248.00 Pln | |
| Ambeed | 25g | 921.06 Pln |
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A532525 |
2-(2-nitrophenyl)acetohydrazide (CAS 114953-81-0) is a chemical compound with the molecular formula C8H9N3O3 and a molecular weight of 195.18 g/mol. IUPAC name: 2-(2-nitrophenyl)acetohydrazide. InChIKey: QCRHPUBNFOAAFJ-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O3 |
|---|---|
| Molecular weight | 195.18 g/mol |
| IUPAC name | 2-(2-nitrophenyl)acetohydrazide |
| InChIKey | QCRHPUBNFOAAFJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)NN)[N+](=O)[O-] |
Computed by PubChem (NCBI)