CAS 957503-54-7 appears in our catalog under these names: 3-(1-Methyl-1h-pyrazol-4-yl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid, 95%, 3-(1-Methyl-1H-pyrazol-4-yl)-4,5-dihydroisoxazole-5-carboxylic acid, 97%, 3-(1-Methyl-1H-pyrazol-4-yl)-4,5-dihydro-isoxazole-5-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
3-(1-methylpyrazol-4-yl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid (CAS 957503-54-7) is a chemical compound with the molecular formula C8H9N3O3 and a molecular weight of 195.18 g/mol. IUPAC name: 3-(1-methylpyrazol-4-yl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid. InChIKey: VLRMILATAWJGMK-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O3 |
|---|---|
| Molecular weight | 195.18 g/mol |
| IUPAC name | 3-(1-methylpyrazol-4-yl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid |
| InChIKey | VLRMILATAWJGMK-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=NOC(C2)C(=O)O |
Computed by PubChem (NCBI)