CAS 5310-92-9 appears in our catalog under these names: N-Methyl-n'-(3-nitrophenyl)urea, 95%, 1-Methyl-3-(3-nitrophenyl)urea, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1-methyl-3-(3-nitrophenyl)urea (CAS 5310-92-9) is a chemical compound with the molecular formula C8H9N3O3 and a molecular weight of 195.18 g/mol. IUPAC name: 1-methyl-3-(3-nitrophenyl)urea. InChIKey: VAKORNMFQJLMTJ-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O3 |
|---|---|
| Molecular weight | 195.18 g/mol |
| IUPAC name | 1-methyl-3-(3-nitrophenyl)urea |
| InChIKey | VAKORNMFQJLMTJ-UHFFFAOYSA-N |
| SMILES | CNC(=O)NC1=CC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)