cas: 1256633-17-6 — see every product listed under this CAS number, including other names
2-(2-Pyridyl)-2-propylamine Dihydrochloride 98% (CAS 1256633-17-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A311143-250mg |
| cas | 1256633-17-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 1955.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A311143 |
2-pyridin-2-ylpropan-2-amine;dihydrochloride (CAS 1256633-17-6) is a chemical compound with the molecular formula C8H14Cl2N2 and a molecular weight of 209.11 g/mol. IUPAC name: 2-pyridin-2-ylpropan-2-amine;dihydrochloride. InChIKey: RXZAGYKUFJSISU-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2 |
|---|---|
| Molecular weight | 209.11 g/mol |
| IUPAC name | 2-pyridin-2-ylpropan-2-amine;dihydrochloride |
| InChIKey | RXZAGYKUFJSISU-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC=N1)N.Cl.Cl |
Computed by PubChem (NCBI)