CAS 1256633-17-6 appears in our catalog under these names: 2-(2-Pyridyl)-2-propylamine dihydrochloride, 97%, 2–(2–Pyridyl)–2–propylamine Dihydrochloride, 2-(2-Pyridyl)-2-propylamine dihydrochloride, 2-(2-Pyridyl)-2-propylamine DiHCl, 98%, 98%, 2-(2-Pyridyl)-2-propylamine dihydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 500mg, 250mg.
2-pyridin-2-ylpropan-2-amine;dihydrochloride (CAS 1256633-17-6) is a chemical compound with the molecular formula C8H14Cl2N2 and a molecular weight of 209.11 g/mol. IUPAC name: 2-pyridin-2-ylpropan-2-amine;dihydrochloride. InChIKey: RXZAGYKUFJSISU-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2 |
|---|---|
| Molecular weight | 209.11 g/mol |
| IUPAC name | 2-pyridin-2-ylpropan-2-amine;dihydrochloride |
| InChIKey | RXZAGYKUFJSISU-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC=N1)N.Cl.Cl |
Computed by PubChem (NCBI)