CAS 16635-94-2 appears in our catalog under these names: 1-Phenylethane-1,2-diamine dihydrochloride, 95%, 1-Phenyl-1,2-ethanediamine Dihydrochloride, 1–Phenylethane–1,2–diamine dihydrochloride, 1-Phenylethane-1,2-diamine dihydrochloride, 1-Phenylethane-1,2-diamine dihydrochloride, 95%, 95%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 5g, 1g, 250mg, 2,5g.
1-phenylethane-1,2-diamine;dihydrochloride (CAS 16635-94-2) is a chemical compound with the molecular formula C8H14Cl2N2 and a molecular weight of 209.11 g/mol. IUPAC name: 1-phenylethane-1,2-diamine;dihydrochloride. InChIKey: ZVHIGOVJILOQNV-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2 |
|---|---|
| Molecular weight | 209.11 g/mol |
| IUPAC name | 1-phenylethane-1,2-diamine;dihydrochloride |
| InChIKey | ZVHIGOVJILOQNV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CN)N.Cl.Cl |
Computed by PubChem (NCBI)